C25H22Cl2N4O4S — CID 3301009
N-[4-[[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]carbamoyl]phenyl]benzamide (PubChem CID 3301009) has the molecular formula C25H22Cl2N4O4S and a molecular weight of 545.45 g/mol. Its IUPAC name is N-[4-[[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 3301009 |
| Molecular Formula | C25H22Cl2N4O4S |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | N-[4-[[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22Cl2N4O4S/c26-18-10-13-21(20(27)15-18)35-14-4-7-22(32)29-25(36)31-30-24(34)17-8-11-19(12-9-17)28-23(33)16-5-2-1-3-6-16/h1-3,5-6,8-13,15H,4,7,14H2,(H,28,33)(H,30,34)(H2,29,31,32,36) |
| InChIKey | YAKYBAIPSLNQQK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|