C17H14Cl4N2O2S — CID 54785867
4-(2,4-dichlorophenoxy)-N-[(2,6-dichlorophenyl)carbamothioyl]butanamide (PubChem CID 54785867) has the molecular formula C17H14Cl4N2O2S and a molecular weight of 452.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-[(2,6-dichlorophenyl)carbamothioyl]butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-[(2,6-dichlorophenyl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 54785867 |
| Molecular Formula | C17H14Cl4N2O2S |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-[(2,6-dichlorophenyl)carbamothioyl]butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl4N2O2S/c18-10-6-7-14(13(21)9-10)25-8-2-5-15(24)22-17(26)23-16-11(19)3-1-4-12(16)20/h1,3-4,6-7,9H,2,5,8H2,(H2,22,23,24,26) |
| InChIKey | RJHAUOYQTZCBSW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|