C19H18Cl2N2O4S — CID 19188466
4-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)butanamide (PubChem CID 19188466) has the molecular formula C19H18Cl2N2O4S and a molecular weight of 441.34 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)butanamide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)butanamide |
|---|---|
| PubChem CID | 19188466 |
| Molecular Formula | C19H18Cl2N2O4S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)butanamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NC(=S)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H18Cl2N2O4S/c20-12-3-5-15(14(21)10-12)25-7-1-2-18(24)23-19(28)22-13-4-6-16-17(11-13)27-9-8-26-16/h3-6,10-11H,1-2,7-9H2,(H2,22,23,24,28) |
| InChIKey | ZLXIZJHMKHQAHU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|