C19H18BrCl2N3O3S — CID 4511141
3-bromo-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-methylbenzamide (PubChem CID 4511141) has the molecular formula C19H18BrCl2N3O3S and a molecular weight of 519.25 g/mol. Its IUPAC name is 3-bromo-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 4511141 |
| Molecular Formula | C19H18BrCl2N3O3S |
| Molecular Weight | 519.25 g/mol |
| Exact Mass | 516.96 |
| IUPAC Name | 3-bromo-N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C19H18BrCl2N3O3S/c1-11-4-5-12(9-14(11)20)18(27)23-19(29)25-24-17(26)3-2-8-28-16-7-6-13(21)10-15(16)22/h4-7,9-10H,2-3,8H2,1H3,(H,24,26)(H2,23,25,27,29) |
| InChIKey | HDOLROUMNVUCKJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.25 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|