C23H27BrCl2N2O4 — CID 4959624
3-bromo-N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-hexoxybenzohydrazide (PubChem CID 4959624) has the molecular formula C23H27BrCl2N2O4 and a molecular weight of 546.29 g/mol. Its IUPAC name is 3-bromo-N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-hexoxybenzohydrazide.
| Compound Name | 3-bromo-N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 4959624 |
| Molecular Formula | C23H27BrCl2N2O4 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | 3-bromo-N'-[4-(2,4-dichlorophenoxy)butanoyl]-4-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C23H27BrCl2N2O4/c1-2-3-4-5-12-31-20-10-8-16(14-18(20)24)23(30)28-27-22(29)7-6-13-32-21-11-9-17(25)15-19(21)26/h8-11,14-15H,2-7,12-13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | MZYPLZNWMNKGEP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|