C20H21Cl2N3O4S — CID 4957804
N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-ethoxybenzamide (PubChem CID 4957804) has the molecular formula C20H21Cl2N3O4S and a molecular weight of 470.38 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-ethoxybenzamide.
| Compound Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 4957804 |
| Molecular Formula | C20H21Cl2N3O4S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-3-ethoxybenzamide |
| SMILES | CCOc1cccc(C(=O)NC(=S)NNC(=O)CCCOc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C20H21Cl2N3O4S/c1-2-28-15-6-3-5-13(11-15)19(27)23-20(30)25-24-18(26)7-4-10-29-17-9-8-14(21)12-16(17)22/h3,5-6,8-9,11-12H,2,4,7,10H2,1H3,(H,24,26)(H2,23,25,27,30) |
| InChIKey | DELLYUIFTMIFCE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|