C19H20ClN3O4S — CID 4960426
N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-3-propoxybenzamide (PubChem CID 4960426) has the molecular formula C19H20ClN3O4S and a molecular weight of 421.91 g/mol. Its IUPAC name is N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-3-propoxybenzamide.
| Compound Name | N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 4960426 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NC(=S)NNC(=O)COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-2-10-26-16-5-3-4-13(11-16)18(25)21-19(28)23-22-17(24)12-27-15-8-6-14(20)7-9-15/h3-9,11H,2,10,12H2,1H3,(H,22,24)(H2,21,23,25,28) |
| InChIKey | SSKWDABOHGLOPY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|