C24H22BrN3O5S — CID 4955421
N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955421) has the molecular formula C24H22BrN3O5S and a molecular weight of 544.43 g/mol. Its IUPAC name is N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955421 |
| Molecular Formula | C24H22BrN3O5S |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | N-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(COc1ccc(Br)cc1)NNC(=S)NC(=O)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C24H22BrN3O5S/c25-18-9-11-20(12-10-18)33-16-22(29)27-28-24(34)26-23(30)17-5-4-8-21(15-17)32-14-13-31-19-6-2-1-3-7-19/h1-12,15H,13-14,16H2,(H,27,29)(H2,26,28,30,34) |
| InChIKey | XQIVCZHHNGVPEC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|