C21H23Br2N3O5S — CID 17140059
N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-3-(2-ethoxyethoxy)benzamide (PubChem CID 17140059) has the molecular formula C21H23Br2N3O5S and a molecular weight of 589.31 g/mol. Its IUPAC name is N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-3-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17140059 |
| Molecular Formula | C21H23Br2N3O5S |
| Molecular Weight | 589.31 g/mol |
| Exact Mass | 586.97 |
| IUPAC Name | N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)NNC(=O)COc2c(C)cc(Br)cc2Br)c1 |
| InChI | InChI=1S/C21H23Br2N3O5S/c1-3-29-7-8-30-16-6-4-5-14(10-16)20(28)24-21(32)26-25-18(27)12-31-19-13(2)9-15(22)11-17(19)23/h4-6,9-11H,3,7-8,12H2,1-2H3,(H,25,27)(H2,24,26,28,32) |
| InChIKey | DJHBUTLZHQOIHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|