C20H21Br2N3O5S — CID 17353934
N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17353934) has the molecular formula C20H21Br2N3O5S and a molecular weight of 575.28 g/mol. Its IUPAC name is N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17353934 |
| Molecular Formula | C20H21Br2N3O5S |
| Molecular Weight | 575.28 g/mol |
| Exact Mass | 572.96 |
| IUPAC Name | N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)NNC(=O)COc2c(C)cc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C20H21Br2N3O5S/c1-12-9-14(21)10-16(22)18(12)30-11-17(26)24-25-20(31)23-19(27)13-3-5-15(6-4-13)29-8-7-28-2/h3-6,9-10H,7-8,11H2,1-2H3,(H,24,26)(H2,23,25,27,31) |
| InChIKey | JMLSFPHHDWKOLG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|