C18H16BrN3O5S — CID 17175795
methyl 3-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioylcarbamoyl]benzoate (PubChem CID 17175795) has the molecular formula C18H16BrN3O5S and a molecular weight of 466.31 g/mol. Its IUPAC name is methyl 3-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175795 |
| Molecular Formula | C18H16BrN3O5S |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | methyl 3-[[[2-(4-bromophenoxy)acetyl]amino]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)NNC(=O)COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C18H16BrN3O5S/c1-26-17(25)12-4-2-3-11(9-12)16(24)20-18(28)22-21-15(23)10-27-14-7-5-13(19)6-8-14/h2-9H,10H2,1H3,(H,21,23)(H2,20,22,24,28) |
| InChIKey | SARODIQHHIOGPI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|