C23H27Cl2N3O4S — CID 4949543
N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 4949543) has the molecular formula C23H27Cl2N3O4S and a molecular weight of 512.46 g/mol. Its IUPAC name is N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4949543 |
| Molecular Formula | C23H27Cl2N3O4S |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-[[4-(2,4-dichlorophenoxy)butanoylamino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)NNC(=O)CCCOc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H27Cl2N3O4S/c1-15(2)11-13-31-18-8-5-16(6-9-18)22(30)26-23(33)28-27-21(29)4-3-12-32-20-10-7-17(24)14-19(20)25/h5-10,14-15H,3-4,11-13H2,1-2H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | HRDUYOQGERIMOV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|