C24H21Cl2N3O4S — CID 4957177
N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 4957177) has the molecular formula C24H21Cl2N3O4S and a molecular weight of 518.42 g/mol. Its IUPAC name is N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 4957177 |
| Molecular Formula | C24H21Cl2N3O4S |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | N-[[[2-(2,4-dichlorophenoxy)acetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NNC(=S)NC(=O)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O4S/c25-18-8-11-21(20(26)14-18)33-15-22(30)28-29-24(34)27-23(31)17-6-9-19(10-7-17)32-13-12-16-4-2-1-3-5-16/h1-11,14H,12-13,15H2,(H,28,30)(H2,27,29,31,34) |
| InChIKey | ZXFHTQSTJMLWSA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|