C25H24ClN3O5S — CID 4953177
N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 4953177) has the molecular formula C25H24ClN3O5S and a molecular weight of 514.00 g/mol. Its IUPAC name is N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4953177 |
| Molecular Formula | C25H24ClN3O5S |
| Molecular Weight | 514.00 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | N-[[[2-(4-chloro-2-methylphenoxy)acetyl]amino]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NNC(=S)NC(=O)c1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24ClN3O5S/c1-17-15-19(26)9-12-22(17)34-16-23(30)28-29-25(35)27-24(31)18-7-10-21(11-8-18)33-14-13-32-20-5-3-2-4-6-20/h2-12,15H,13-14,16H2,1H3,(H,28,30)(H2,27,29,31,35) |
| InChIKey | UPMMGWBGHQYBEW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.00 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|