C17H18ClNO3 — CID 26903383
2-(4-chloro-2-methylphenoxy)-N-(2-phenoxyethyl)acetamide (PubChem CID 26903383) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 26903383 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-(2-phenoxyethyl)acetamide |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C17H18ClNO3/c1-13-11-14(18)7-8-16(13)22-12-17(20)19-9-10-21-15-5-3-2-4-6-15/h2-8,11H,9-10,12H2,1H3,(H,19,20) |
| InChIKey | QYXVLLGDGRMDFT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|