C21H24Cl2N2O3 — CID 4530961
N-tert-butyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]benzamide (PubChem CID 4530961) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]benzamide.
| Compound Name | N-tert-butyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 4530961 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-tert-butyl-2-[4-(2,4-dichlorophenoxy)butanoylamino]benzamide |
| SMILES | CC(C)(C)NC(=O)c1ccccc1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O3/c1-21(2,3)25-20(27)15-7-4-5-8-17(15)24-19(26)9-6-12-28-18-11-10-14(22)13-16(18)23/h4-5,7-8,10-11,13H,6,9,12H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | AJNVIXFJQUWHML-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|