C17H16Cl2N2O3 — CID 87036675
3-[3-(2,4-dichlorophenoxy)propanoylamino]-2-methylbenzamide (PubChem CID 87036675) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenoxy)propanoylamino]-2-methylbenzamide.
| Compound Name | 3-[3-(2,4-dichlorophenoxy)propanoylamino]-2-methylbenzamide |
|---|---|
| PubChem CID | 87036675 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-[3-(2,4-dichlorophenoxy)propanoylamino]-2-methylbenzamide |
| SMILES | Cc1c(NC(=O)CCOc2ccc(Cl)cc2Cl)cccc1C(N)=O |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-10-12(17(20)23)3-2-4-14(10)21-16(22)7-8-24-15-6-5-11(18)9-13(15)19/h2-6,9H,7-8H2,1H3,(H2,20,23)(H,21,22) |
| InChIKey | OCRRKZHMPWDZOK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |