C10H11ClN2O2 — CID 43698457
3-[(2-chloroacetyl)amino]-2-methylbenzamide (PubChem CID 43698457) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 3-[(2-chloroacetyl)amino]-2-methylbenzamide.
| Compound Name | 3-[(2-chloroacetyl)amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 43698457 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-[(2-chloroacetyl)amino]-2-methylbenzamide |
| SMILES | Cc1c(NC(=O)CCl)cccc1C(N)=O |
| InChI | InChI=1S/C10H11ClN2O2/c1-6-7(10(12)15)3-2-4-8(6)13-9(14)5-11/h2-4H,5H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | BAJNANXYUFFDLC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|