C11H12ClN3O3 — CID 24878934
N-carbamoyl-3-[(2-chloroacetyl)amino]-2-methylbenzamide (PubChem CID 24878934) has the molecular formula C11H12ClN3O3 and a molecular weight of 269.69 g/mol. Its IUPAC name is N-carbamoyl-3-[(2-chloroacetyl)amino]-2-methylbenzamide.
| Compound Name | N-carbamoyl-3-[(2-chloroacetyl)amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 24878934 |
| Molecular Formula | C11H12ClN3O3 |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | N-carbamoyl-3-[(2-chloroacetyl)amino]-2-methylbenzamide |
| SMILES | Cc1c(NC(=O)CCl)cccc1C(=O)NC(N)=O |
| InChI | InChI=1S/C11H12ClN3O3/c1-6-7(10(17)15-11(13)18)3-2-4-8(6)14-9(16)5-12/h2-4H,5H2,1H3,(H,14,16)(H3,13,15,17,18) |
| InChIKey | BBQCTBNJLWGFKL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|