C10H10ClNO4 — CID 50989106
methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate (PubChem CID 50989106) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 50989106 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCl)c1O |
| InChI | InChI=1S/C10H10ClNO4/c1-16-10(15)6-3-2-4-7(9(6)14)12-8(13)5-11/h2-4,14H,5H2,1H3,(H,12,13) |
| InChIKey | CRHWVLRCALYRQO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|