C17H17ClN2O7 — CID 160717436
3-amino-2-hydroxybenzoic acid;methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate (PubChem CID 160717436) has the molecular formula C17H17ClN2O7 and a molecular weight of 396.78 g/mol. Its IUPAC name is 3-amino-2-hydroxybenzoic acid;methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate.
| Compound Name | 3-amino-2-hydroxybenzoic acid;methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 160717436 |
| Molecular Formula | C17H17ClN2O7 |
| Molecular Weight | 396.78 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-amino-2-hydroxybenzoic acid;methyl 3-[(2-chloroacetyl)amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCl)c1O.Nc1cccc(C(=O)O)c1O |
| InChI | InChI=1S/C10H10ClNO4.C7H7NO3/c1-16-10(15)6-3-2-4-7(9(6)14)12-8(13)5-11;8-5-3-1-2-4(6(5)9)7(10)11/h2-4,14H,5H2,1H3,(H,12,13);1-3,9H,8H2,(H,10,11) |
| InChIKey | RSQUASXNQHPMHQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|