C15H20ClNO5 — CID 19000977
3-(7-chloroheptoxycarbonylamino)-2-hydroxybenzoic acid (PubChem CID 19000977) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is 3-(7-chloroheptoxycarbonylamino)-2-hydroxybenzoic acid.
| Compound Name | 3-(7-chloroheptoxycarbonylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19000977 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-(7-chloroheptoxycarbonylamino)-2-hydroxybenzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1O)OCCCCCCCCl |
| InChI | InChI=1S/C15H20ClNO5/c16-9-4-2-1-3-5-10-22-15(21)17-12-8-6-7-11(13(12)18)14(19)20/h6-8,18H,1-5,9-10H2,(H,17,21)(H,19,20) |
| InChIKey | YROUNBRCUQAQCL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|