C13H15ClF3NO2 — CID 103970739
5-chloropentyl N-[2-(trifluoromethyl)phenyl]carbamate (PubChem CID 103970739) has the molecular formula C13H15ClF3NO2 and a molecular weight of 309.71 g/mol. Its IUPAC name is 5-chloropentyl N-[2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 5-chloropentyl N-[2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 103970739 |
| Molecular Formula | C13H15ClF3NO2 |
| Molecular Weight | 309.71 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-chloropentyl N-[2-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)OCCCCCCl |
| InChI | InChI=1S/C13H15ClF3NO2/c14-8-4-1-5-9-20-12(19)18-11-7-3-2-6-10(11)13(15,16)17/h2-3,6-7H,1,4-5,8-9H2,(H,18,19) |
| InChIKey | IWRRSVUOZXMPNZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|