C14H16F3NO2 — CID 127539075
cyclohexyl N-[2-(trifluoromethyl)phenyl]carbamate (PubChem CID 127539075) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is cyclohexyl N-[2-(trifluoromethyl)phenyl]carbamate.
| Compound Name | cyclohexyl N-[2-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 127539075 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | cyclohexyl N-[2-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)OC1CCCCC1 |
| InChI | InChI=1S/C14H16F3NO2/c15-14(16,17)11-8-4-5-9-12(11)18-13(19)20-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2,(H,18,19) |
| InChIKey | GEXADMLKPDJOIW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |