C18H21F3N2O4 — CID 7807697
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(cyclohexanecarbonylamino)acetate (PubChem CID 7807697) has the molecular formula C18H21F3N2O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 7807697 |
| Molecular Formula | C18H21F3N2O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C1CCCCC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H21F3N2O4/c19-18(20,21)13-8-4-5-9-14(13)23-15(24)11-27-16(25)10-22-17(26)12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,22,26)(H,23,24) |
| InChIKey | DNLAHEOTXPDIAF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |