C17H21ClN2O4 — CID 2547405
[2-(4-chloroanilino)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate (PubChem CID 2547405) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 2547405 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C1CCCCC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O4/c18-13-6-8-14(9-7-13)20-15(21)11-24-16(22)10-19-17(23)12-4-2-1-3-5-12/h6-9,12H,1-5,10-11H2,(H,19,23)(H,20,21) |
| InChIKey | VKYGMLIFPURAFO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |