C15H18ClNO4S — CID 2510921
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate (PubChem CID 2510921) has the molecular formula C15H18ClNO4S and a molecular weight of 343.83 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate |
|---|---|
| PubChem CID | 2510921 |
| Molecular Formula | C15H18ClNO4S |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-(cyclohexanecarbonylamino)acetate |
| SMILES | O=C(CNC(=O)C1CCCCC1)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H18ClNO4S/c16-13-7-6-12(22-13)11(18)9-21-14(19)8-17-15(20)10-4-2-1-3-5-10/h6-7,10H,1-5,8-9H2,(H,17,20) |
| InChIKey | DDEDPCGMWVVAFS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |