C16H14ClNO4S — CID 46796053
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(2-methylbenzoyl)amino]acetate (PubChem CID 46796053) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(2-methylbenzoyl)amino]acetate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(2-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46796053 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-[(2-methylbenzoyl)amino]acetate |
| SMILES | Cc1ccccc1C(=O)NCC(=O)OCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H14ClNO4S/c1-10-4-2-3-5-11(10)16(21)18-8-15(20)22-9-12(19)13-6-7-14(17)23-13/h2-7H,8-9H2,1H3,(H,18,21) |
| InChIKey | XWBZBORNACAYNI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |