C19H18INO4 — CID 29179948
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate (PubChem CID 29179948) has the molecular formula C19H18INO4 and a molecular weight of 451.26 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 29179948 |
| Molecular Formula | C19H18INO4 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)CNC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C19H18INO4/c1-12-7-8-13(2)15(9-12)17(22)11-25-18(23)10-21-19(24)14-5-3-4-6-16(14)20/h3-9H,10-11H2,1-2H3,(H,21,24) |
| InChIKey | LRUCBIPIEJBXKU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|