C19H19NO4 — CID 2625404
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 2625404) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 2625404 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)CNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C19H19NO4/c1-13-8-9-14(2)16(10-13)17(21)12-24-18(22)11-20-19(23)15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | QWGBRMNJOCUAQF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |