C21H22N2O5 — CID 46795940
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(2-methylbenzoyl)amino]acetate (PubChem CID 46795940) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(2-methylbenzoyl)amino]acetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(2-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 46795940 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(2-methylbenzoyl)amino]acetate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)CNC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-3-19(25)23-16-10-8-15(9-11-16)18(24)13-28-20(26)12-22-21(27)17-7-5-4-6-14(17)2/h4-11H,3,12-13H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | WAIIICJRAJXJKO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |