C19H18ClN3O5 — CID 8853560
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-chloropyridine-2-carbonyl)amino]acetate (PubChem CID 8853560) has the molecular formula C19H18ClN3O5 and a molecular weight of 403.82 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-chloropyridine-2-carbonyl)amino]acetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-chloropyridine-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 8853560 |
| Molecular Formula | C19H18ClN3O5 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-[(4-chloropyridine-2-carbonyl)amino]acetate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)CNC(=O)c2cc(Cl)ccn2)cc1 |
| InChI | InChI=1S/C19H18ClN3O5/c1-2-17(25)23-14-5-3-12(4-6-14)16(24)11-28-18(26)10-22-19(27)15-9-13(20)7-8-21-15/h3-9H,2,10-11H2,1H3,(H,22,27)(H,23,25) |
| InChIKey | XMRSAPLLAIATGZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |