C15H19NO5 — CID 8709346
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-ethoxyacetate (PubChem CID 8709346) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-ethoxyacetate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 8709346 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)c1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C15H19NO5/c1-3-14(18)16-12-7-5-11(6-8-12)13(17)9-21-15(19)10-20-4-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | OPAWLTGTDZYKKA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |