C22H23NO5S — CID 7829152
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate (PubChem CID 7829152) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7829152 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 4-(4-methylsulfanylphenyl)-4-oxobutanoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)CCC(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C22H23NO5S/c1-3-21(26)23-17-8-4-16(5-9-17)20(25)14-28-22(27)13-12-19(24)15-6-10-18(29-2)11-7-15/h4-11H,3,12-14H2,1-2H3,(H,23,26) |
| InChIKey | DGRUNFAXEWAJGM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |