C23H24BrNO5 — CID 55306427
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate (PubChem CID 55306427) has the molecular formula C23H24BrNO5 and a molecular weight of 474.35 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 55306427 |
| Molecular Formula | C23H24BrNO5 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-(4-bromophenyl)-4-oxobutanoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)CCC(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H24BrNO5/c1-15(2)13-22(28)25-19-9-5-17(6-10-19)21(27)14-30-23(29)12-11-20(26)16-3-7-18(24)8-4-16/h3-10,15H,11-14H2,1-2H3,(H,25,28) |
| InChIKey | ZQQTWUKUIVQVME-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |