C20H20BrNO4 — CID 7663009
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-bromobenzoate (PubChem CID 7663009) has the molecular formula C20H20BrNO4 and a molecular weight of 418.29 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-bromobenzoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 7663009 |
| Molecular Formula | C20H20BrNO4 |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 3-bromobenzoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C20H20BrNO4/c1-13(2)10-19(24)22-17-8-6-14(7-9-17)18(23)12-26-20(25)15-4-3-5-16(21)11-15/h3-9,11,13H,10,12H2,1-2H3,(H,22,24) |
| InChIKey | ABXMKKIPNVUUEH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |