C23H23N3O5 — CID 7808244
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 7808244) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 7808244 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)c2ccc(NC(=O)CC#N)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O5/c1-15(2)13-22(29)26-19-7-3-16(4-8-19)20(27)14-31-23(30)17-5-9-18(10-6-17)25-21(28)11-12-24/h3-10,15H,11,13-14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | SJUCETKJIOBJDN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |