C19H14N4O4 — CID 2548822
[2-(4-cyanoanilino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 2548822) has the molecular formula C19H14N4O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is [2-(4-cyanoanilino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [2-(4-cyanoanilino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 2548822 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | [2-(4-cyanoanilino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCC(=O)Nc2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C19H14N4O4/c20-10-9-17(24)22-16-7-3-14(4-8-16)19(26)27-12-18(25)23-15-5-1-13(11-21)2-6-15/h1-8H,9,12H2,(H,22,24)(H,23,25) |
| InChIKey | QSGPCNNPCLFJBE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |