C19H15N3O5 — CID 7808266
(2-benzamido-2-oxoethyl) 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 7808266) has the molecular formula C19H15N3O5 and a molecular weight of 365.35 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | (2-benzamido-2-oxoethyl) 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 7808266 |
| Molecular Formula | C19H15N3O5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | N#CCC(=O)Nc1ccc(C(=O)OCC(=O)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15N3O5/c20-11-10-16(23)21-15-8-6-14(7-9-15)19(26)27-12-17(24)22-18(25)13-4-2-1-3-5-13/h1-9H,10,12H2,(H,21,23)(H,22,24,25) |
| InChIKey | ZUQNXEXCTPUYNQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |