C17H20N4O5 — CID 2548621
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 2548621) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 2548621 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)c1ccc(NC(=O)CC#N)cc1 |
| InChI | InChI=1S/C17H20N4O5/c1-17(2,3)21-16(25)20-14(23)10-26-15(24)11-4-6-12(7-5-11)19-13(22)8-9-18/h4-7H,8,10H2,1-3H3,(H,19,22)(H2,20,21,23,25) |
| InChIKey | AAMZDOXFQNSNBJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |