C13H17N3O5 — CID 2417901
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 2417901) has the molecular formula C13H17N3O5 and a molecular weight of 295.29 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 2417901 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)c1cc[n+]([O-])cc1 |
| InChI | InChI=1S/C13H17N3O5/c1-13(2,3)15-12(19)14-10(17)8-21-11(18)9-4-6-16(20)7-5-9/h4-7H,8H2,1-3H3,(H2,14,15,17,19) |
| InChIKey | LOAWYMQCTVSJAA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|