C9H16N2O4 — CID 2108654
[2-(tert-butylcarbamoylamino)-2-oxoethyl] acetate (PubChem CID 2108654) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] acetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 2108654 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C9H16N2O4/c1-6(12)15-5-7(13)10-8(14)11-9(2,3)4/h5H2,1-4H3,(H2,10,11,13,14) |
| InChIKey | DBJISTSGXGXPJK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |