C22H26N2O4 — CID 2565014
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 2565014) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 2565014 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-22(2,3)24-21(27)23-19(25)15-28-20(26)14-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3,(H2,23,24,25,27) |
| InChIKey | GXVFXABPYCIXJJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |