C15H19N3O6S — CID 7992163
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)sulfanylacetate (PubChem CID 7992163) has the molecular formula C15H19N3O6S and a molecular weight of 369.40 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)sulfanylacetate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7992163 |
| Molecular Formula | C15H19N3O6S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-(2-nitrophenyl)sulfanylacetate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O6S/c1-15(2,3)17-14(21)16-12(19)8-24-13(20)9-25-11-7-5-4-6-10(11)18(22)23/h4-7H,8-9H2,1-3H3,(H2,16,17,19,21) |
| InChIKey | KLSPLNGYYQEWQR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|