C15H20N2O5S — CID 7992231
[2-oxo-2-(pentan-3-ylamino)ethyl] 2-(2-nitrophenyl)sulfanylacetate (PubChem CID 7992231) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(2-nitrophenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7992231 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-(2-nitrophenyl)sulfanylacetate |
| SMILES | CCC(CC)NC(=O)COC(=O)CSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N2O5S/c1-3-11(4-2)16-14(18)9-22-15(19)10-23-13-8-6-5-7-12(13)17(20)21/h5-8,11H,3-4,9-10H2,1-2H3,(H,16,18) |
| InChIKey | KWZPWBIIYWBXHJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|