C19H27N3O5 — CID 55315761
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-benzamido-3-methylbutanoate (PubChem CID 55315761) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-benzamido-3-methylbutanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-benzamido-3-methylbutanoate |
|---|---|
| PubChem CID | 55315761 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 2-benzamido-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccccc1)C(=O)OCC(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H27N3O5/c1-12(2)15(21-16(24)13-9-7-6-8-10-13)17(25)27-11-14(23)20-18(26)22-19(3,4)5/h6-10,12,15H,11H2,1-5H3,(H,21,24)(H2,20,22,23,26) |
| InChIKey | OELQUYKXPVQZRX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |