C18H25FN2O4 — CID 9491978
[2-(tert-butylamino)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 9491978) has the molecular formula C18H25FN2O4 and a molecular weight of 352.41 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 9491978 |
| Molecular Formula | C18H25FN2O4 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] (2S)-2-[(4-fluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)cc1)C(=O)OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H25FN2O4/c1-11(2)15(17(24)25-10-14(22)21-18(3,4)5)20-16(23)12-6-8-13(19)9-7-12/h6-9,11,15H,10H2,1-5H3,(H,20,23)(H,21,22)/t15-/m0/s1 |
| InChIKey | URCSBVAACUSKJA-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |