C23H28FNO3 — CID 7564642
(4-fluorophenyl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate (PubChem CID 7564642) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is (4-fluorophenyl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate.
| Compound Name | (4-fluorophenyl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7564642 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (4-fluorophenyl)methyl (2S)-2-[(4-tert-butylbenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H28FNO3/c1-15(2)20(22(27)28-14-16-6-12-19(24)13-7-16)25-21(26)17-8-10-18(11-9-17)23(3,4)5/h6-13,15,20H,14H2,1-5H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | UESBWLVXDDUUEV-FQEVSTJZSA-N |
| XLogP | 4.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |