C20H20F2N2O4 — CID 27319913
(4-carbamoylphenyl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 27319913) has the molecular formula C20H20F2N2O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (4-carbamoylphenyl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 27319913 |
| Molecular Formula | C20H20F2N2O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4-carbamoylphenyl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)OCc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C20H20F2N2O4/c1-11(2)17(24-19(26)16-14(21)4-3-5-15(16)22)20(27)28-10-12-6-8-13(9-7-12)18(23)25/h3-9,11,17H,10H2,1-2H3,(H2,23,25)(H,24,26)/t17-/m0/s1 |
| InChIKey | VIZWBJIACWOADL-KRWDZBQOSA-N |
| XLogP | 2.56 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |