C21H18F2N2O5 — CID 2400973
(1,3-dioxoisoindol-2-yl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate (PubChem CID 2400973) has the molecular formula C21H18F2N2O5 and a molecular weight of 416.38 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 2400973 |
| Molecular Formula | C21H18F2N2O5 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl (2S)-2-[(2,6-difluorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)c1c(F)cccc1F)C(=O)OCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H18F2N2O5/c1-11(2)17(24-18(26)16-14(22)8-5-9-15(16)23)21(29)30-10-25-19(27)12-6-3-4-7-13(12)20(25)28/h3-9,11,17H,10H2,1-2H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | AKQBRDJVWDQPMS-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|